C19H25N3OS — CID 71883760
N-[4-(4-azatricyclo[4.3.1.13,8]undecane-4-carbothioylamino)phenyl]acetamide (PubChem CID 71883760) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-[4-(4-azatricyclo[4.3.1.13,8]undecane-4-carbothioylamino)phenyl]acetamide.
| Compound Name | N-[4-(4-azatricyclo[4.3.1.13,8]undecane-4-carbothioylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 71883760 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[4-(4-azatricyclo[4.3.1.13,8]undecane-4-carbothioylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)N2CC3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C19H25N3OS/c1-12(23)20-16-2-4-17(5-3-16)21-19(24)22-11-15-7-13-6-14(8-15)10-18(22)9-13/h2-5,13-15,18H,6-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | LSIJWLBLSIZPIN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|