C22H18N2O3S — CID 71888006
3-oxopentan-2-yl 2-(1,3-benzothiazol-2-yl)quinoline-4-carboxylate (PubChem CID 71888006) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-oxopentan-2-yl 2-(1,3-benzothiazol-2-yl)quinoline-4-carboxylate.
| Compound Name | 3-oxopentan-2-yl 2-(1,3-benzothiazol-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 71888006 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-oxopentan-2-yl 2-(1,3-benzothiazol-2-yl)quinoline-4-carboxylate |
| SMILES | CCC(=O)C(C)OC(=O)c1cc(-c2nc3ccccc3s2)nc2ccccc12 |
| InChI | InChI=1S/C22H18N2O3S/c1-3-19(25)13(2)27-22(26)15-12-18(23-16-9-5-4-8-14(15)16)21-24-17-10-6-7-11-20(17)28-21/h4-13H,3H2,1-2H3 |
| InChIKey | HOWLABRYSKHRGW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |