C20H17N5O2 — CID 71888481
2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-(2-ethyl-1,3-benzoxazol-5-yl)prop-2-enamide (PubChem CID 71888481) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-(2-ethyl-1,3-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-(2-ethyl-1,3-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71888481 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-(2-ethyl-1,3-benzoxazol-5-yl)prop-2-enamide |
| SMILES | CCc1nc2cc(NC(=O)C(C#N)=Cc3cc(C#N)n(C)c3C)ccc2o1 |
| InChI | InChI=1S/C20H17N5O2/c1-4-19-24-17-9-15(5-6-18(17)27-19)23-20(26)14(10-21)7-13-8-16(11-22)25(3)12(13)2/h5-9H,4H2,1-3H3,(H,23,26) |
| InChIKey | OUZWHILEFIARJD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|