C17H14FN5O — CID 167829340
(E)-2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N'-(4-fluorophenyl)prop-2-enehydrazide (PubChem CID 167829340) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is (E)-2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N'-(4-fluorophenyl)prop-2-enehydrazide.
| Compound Name | (E)-2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N'-(4-fluorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 167829340 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N'-(4-fluorophenyl)prop-2-enehydrazide |
| SMILES | Cc1c(/C=C(\C#N)C(=O)NNc2ccc(F)cc2)cc(C#N)n1C |
| InChI | InChI=1S/C17H14FN5O/c1-11-12(8-16(10-20)23(11)2)7-13(9-19)17(24)22-21-15-5-3-14(18)4-6-15/h3-8,21H,1-2H3,(H,22,24)/b13-7+ |
| InChIKey | QNNIGZWHGJEDSE-NTUHNPAUSA-N |
| XLogP | 2.39 |
| TPSA | 93.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|