C18H18N4O3 — CID 111912262
2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]prop-2-enamide (PubChem CID 111912262) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]prop-2-enamide.
| Compound Name | 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]prop-2-enamide |
|---|---|
| PubChem CID | 111912262 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-[2-(furan-2-yl)-2-hydroxypropyl]prop-2-enamide |
| SMILES | Cc1c(C=C(C#N)C(=O)NCC(C)(O)c2ccco2)cc(C#N)n1C |
| InChI | InChI=1S/C18H18N4O3/c1-12-13(8-15(10-20)22(12)3)7-14(9-19)17(23)21-11-18(2,24)16-5-4-6-25-16/h4-8,24H,11H2,1-3H3,(H,21,23) |
| InChIKey | UJAYPVQIHBGQBO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|