C23H20N2O3 — CID 71890191
3-naphthalen-1-yl-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]prop-2-enamide (PubChem CID 71890191) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-naphthalen-1-yl-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | 3-naphthalen-1-yl-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71890191 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-naphthalen-1-yl-N-[4-[(2-oxo-1,3-oxazolidin-3-yl)methyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc2ccccc12)Nc1ccc(CN2CCOC2=O)cc1 |
| InChI | InChI=1S/C23H20N2O3/c26-22(13-10-19-6-3-5-18-4-1-2-7-21(18)19)24-20-11-8-17(9-12-20)16-25-14-15-28-23(25)27/h1-13H,14-16H2,(H,24,26) |
| InChIKey | YEIUUIJDJNEULE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|