C20H22ClN3O3 — CID 71890939
[2-(cyclopentylcarbamoyl)phenyl] 3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 71890939) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoyl)phenyl] 3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(cyclopentylcarbamoyl)phenyl] 3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71890939 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-(cyclopentylcarbamoyl)phenyl] 3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(Cl)c1C=CC(=O)Oc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-13-15(19(21)24(2)23-13)11-12-18(25)27-17-10-6-5-9-16(17)20(26)22-14-7-3-4-8-14/h5-6,9-12,14H,3-4,7-8H2,1-2H3,(H,22,26) |
| InChIKey | SDQMNZWTYKDCGB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|