C17H11ClN2O4S — CID 71894468
6-chloro-N-(4-cyanophenyl)sulfonyl-2H-chromene-3-carboxamide (PubChem CID 71894468) has the molecular formula C17H11ClN2O4S and a molecular weight of 374.81 g/mol. Its IUPAC name is 6-chloro-N-(4-cyanophenyl)sulfonyl-2H-chromene-3-carboxamide.
| Compound Name | 6-chloro-N-(4-cyanophenyl)sulfonyl-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 71894468 |
| Molecular Formula | C17H11ClN2O4S |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 6-chloro-N-(4-cyanophenyl)sulfonyl-2H-chromene-3-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC(=O)C2=Cc3cc(Cl)ccc3OC2)cc1 |
| InChI | InChI=1S/C17H11ClN2O4S/c18-14-3-6-16-12(8-14)7-13(10-24-16)17(21)20-25(22,23)15-4-1-11(9-19)2-5-15/h1-8H,10H2,(H,20,21) |
| InChIKey | QPUFXDZRFKTIAD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |