C12H24N4O4S — CID 71896140
3-N-[3-[methyl(methylsulfonyl)amino]propyl]piperidine-1,3-dicarboxamide (PubChem CID 71896140) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-N-[3-[methyl(methylsulfonyl)amino]propyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-[methyl(methylsulfonyl)amino]propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71896140 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-N-[3-[methyl(methylsulfonyl)amino]propyl]piperidine-1,3-dicarboxamide |
| SMILES | CN(CCCNC(=O)C1CCCN(C(N)=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C12H24N4O4S/c1-15(21(2,19)20)7-4-6-14-11(17)10-5-3-8-16(9-10)12(13)18/h10H,3-9H2,1-2H3,(H2,13,18)(H,14,17) |
| InChIKey | QQUGDWTYFKILJF-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|