C18H26N2O5S — CID 71911072
1-[3-(3-acetylphenoxy)-2-hydroxypropyl]-N-cyclopropylpyrrolidine-3-sulfonamide (PubChem CID 71911072) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[3-(3-acetylphenoxy)-2-hydroxypropyl]-N-cyclopropylpyrrolidine-3-sulfonamide.
| Compound Name | 1-[3-(3-acetylphenoxy)-2-hydroxypropyl]-N-cyclopropylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 71911072 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[3-(3-acetylphenoxy)-2-hydroxypropyl]-N-cyclopropylpyrrolidine-3-sulfonamide |
| SMILES | CC(=O)c1cccc(OCC(O)CN2CCC(S(=O)(=O)NC3CC3)C2)c1 |
| InChI | InChI=1S/C18H26N2O5S/c1-13(21)14-3-2-4-17(9-14)25-12-16(22)10-20-8-7-18(11-20)26(23,24)19-15-5-6-15/h2-4,9,15-16,18-19,22H,5-8,10-12H2,1H3 |
| InChIKey | SOWXVCDNJVLHRO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |