C20H31N3O4 — CID 71911905
methyl N-[1-[4-(4-ethoxyphenyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 71911905) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is methyl N-[1-[4-(4-ethoxyphenyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | methyl N-[1-[4-(4-ethoxyphenyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 71911905 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | methyl N-[1-[4-(4-ethoxyphenyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCOc1ccc(N2CCN(C(=O)C(CC(C)C)NC(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O4/c1-5-27-17-8-6-16(7-9-17)22-10-12-23(13-11-22)19(24)18(14-15(2)3)21-20(25)26-4/h6-9,15,18H,5,10-14H2,1-4H3,(H,21,25) |
| InChIKey | JLJYKKKOPWCEBJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|