C17H12F2N2O2 — CID 71913083
1-[4-(difluoromethoxy)phenyl]-3-imidazo[1,2-a]pyridin-5-ylprop-2-en-1-one (PubChem CID 71913083) has the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-imidazo[1,2-a]pyridin-5-ylprop-2-en-1-one.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-imidazo[1,2-a]pyridin-5-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71913083 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-imidazo[1,2-a]pyridin-5-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc2nccn12)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H12F2N2O2/c18-17(19)23-14-7-4-12(5-8-14)15(22)9-6-13-2-1-3-16-20-10-11-21(13)16/h1-11,17H |
| InChIKey | AGQBABZSMVOWEK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|