C13H12N4O5S — CID 71915318
5-ethylsulfonyl-2-[(4-nitroimidazol-1-yl)methyl]-1,3-benzoxazole (PubChem CID 71915318) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is 5-ethylsulfonyl-2-[(4-nitroimidazol-1-yl)methyl]-1,3-benzoxazole.
| Compound Name | 5-ethylsulfonyl-2-[(4-nitroimidazol-1-yl)methyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 71915318 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-ethylsulfonyl-2-[(4-nitroimidazol-1-yl)methyl]-1,3-benzoxazole |
| SMILES | CCS(=O)(=O)c1ccc2oc(Cn3cnc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C13H12N4O5S/c1-2-23(20,21)9-3-4-11-10(5-9)15-13(22-11)7-16-6-12(14-8-16)17(18)19/h3-6,8H,2,7H2,1H3 |
| InChIKey | ZZEAYWVPNOFWJM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 121.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|