C20H20N2O3 — CID 71920872
1-benzyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobutane-1-carboxamide (PubChem CID 71920872) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-benzyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-benzyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 71920872 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-benzyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobutane-1-carboxamide |
| SMILES | O=C1COc2cc(NC(=O)C3(Cc4ccccc4)CCC3)ccc2N1 |
| InChI | InChI=1S/C20H20N2O3/c23-18-13-25-17-11-15(7-8-16(17)22-18)21-19(24)20(9-4-10-20)12-14-5-2-1-3-6-14/h1-3,5-8,11H,4,9-10,12-13H2,(H,21,24)(H,22,23) |
| InChIKey | NGPBNJHZZBFAIC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |