C17H20N2O2S2 — CID 71922016
2-benzyl-N-[(4-hydroxythian-4-yl)methyl]-1,3-thiazole-5-carboxamide (PubChem CID 71922016) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-benzyl-N-[(4-hydroxythian-4-yl)methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[(4-hydroxythian-4-yl)methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71922016 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-benzyl-N-[(4-hydroxythian-4-yl)methyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCC1(O)CCSCC1)c1cnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C17H20N2O2S2/c20-16(19-12-17(21)6-8-22-9-7-17)14-11-18-15(23-14)10-13-4-2-1-3-5-13/h1-5,11,21H,6-10,12H2,(H,19,20) |
| InChIKey | DGJMIKFWGAPQOL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |