C15H16ClN3O3 — CID 71925099
methyl 2-chloro-4-[[methyl(1H-pyrrol-2-ylmethyl)carbamoyl]amino]benzoate (PubChem CID 71925099) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is methyl 2-chloro-4-[[methyl(1H-pyrrol-2-ylmethyl)carbamoyl]amino]benzoate.
| Compound Name | methyl 2-chloro-4-[[methyl(1H-pyrrol-2-ylmethyl)carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 71925099 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | methyl 2-chloro-4-[[methyl(1H-pyrrol-2-ylmethyl)carbamoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N(C)Cc2ccc[nH]2)cc1Cl |
| InChI | InChI=1S/C15H16ClN3O3/c1-19(9-11-4-3-7-17-11)15(21)18-10-5-6-12(13(16)8-10)14(20)22-2/h3-8,17H,9H2,1-2H3,(H,18,21) |
| InChIKey | IZWJDQRCDJUFHZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |