C13H18ClFN2O3S — CID 71929526
N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-(methanesulfonamido)-2-methylpropanamide (PubChem CID 71929526) has the molecular formula C13H18ClFN2O3S and a molecular weight of 336.82 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-(methanesulfonamido)-2-methylpropanamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-(methanesulfonamido)-2-methylpropanamide |
|---|---|
| PubChem CID | 71929526 |
| Molecular Formula | C13H18ClFN2O3S |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenyl)ethyl]-2-(methanesulfonamido)-2-methylpropanamide |
| SMILES | CC(C)(NS(C)(=O)=O)C(=O)NCCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2O3S/c1-13(2,17-21(3,19)20)12(18)16-7-6-9-4-5-10(15)8-11(9)14/h4-5,8,17H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | LPQHHCSDWKIERR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |