C16H21FN2O2S — CID 71931032
N-[3-[1-(3-fluorophenyl)-2-oxopiperidin-3-yl]sulfanylpropyl]acetamide (PubChem CID 71931032) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[3-[1-(3-fluorophenyl)-2-oxopiperidin-3-yl]sulfanylpropyl]acetamide.
| Compound Name | N-[3-[1-(3-fluorophenyl)-2-oxopiperidin-3-yl]sulfanylpropyl]acetamide |
|---|---|
| PubChem CID | 71931032 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[3-[1-(3-fluorophenyl)-2-oxopiperidin-3-yl]sulfanylpropyl]acetamide |
| SMILES | CC(=O)NCCCSC1CCCN(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C16H21FN2O2S/c1-12(20)18-8-4-10-22-15-7-3-9-19(16(15)21)14-6-2-5-13(17)11-14/h2,5-6,11,15H,3-4,7-10H2,1H3,(H,18,20) |
| InChIKey | QMGMKQYCCLKTDO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|