C18H23N3O4 — CID 71940975
1-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-3-[2-(4-methoxyphenyl)ethyl]urea (PubChem CID 71940975) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-3-[2-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 71940975 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[1-(2-methoxyethyl)-6-oxo-3-pyridinyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
| SMILES | COCCn1cc(NC(=O)NCCc2ccc(OC)cc2)ccc1=O |
| InChI | InChI=1S/C18H23N3O4/c1-24-12-11-21-13-15(5-8-17(21)22)20-18(23)19-10-9-14-3-6-16(25-2)7-4-14/h3-8,13H,9-12H2,1-2H3,(H2,19,20,23) |
| InChIKey | SUJFIIBSPRSWCN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |