C18H16ClNO4S2 — CID 71946672
7-chloro-N-[2-(4-methoxyphenyl)sulfonylethyl]-1-benzothiophene-3-carboxamide (PubChem CID 71946672) has the molecular formula C18H16ClNO4S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 7-chloro-N-[2-(4-methoxyphenyl)sulfonylethyl]-1-benzothiophene-3-carboxamide.
| Compound Name | 7-chloro-N-[2-(4-methoxyphenyl)sulfonylethyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 71946672 |
| Molecular Formula | C18H16ClNO4S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 7-chloro-N-[2-(4-methoxyphenyl)sulfonylethyl]-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)CCNC(=O)c2csc3c(Cl)cccc23)cc1 |
| InChI | InChI=1S/C18H16ClNO4S2/c1-24-12-5-7-13(8-6-12)26(22,23)10-9-20-18(21)15-11-25-17-14(15)3-2-4-16(17)19/h2-8,11H,9-10H2,1H3,(H,20,21) |
| InChIKey | QUCMNOYNESRZMX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |