C20H17N3O2 — CID 71950270
2-cyano-N-(3-ethoxyphenyl)-3-(1H-indol-2-yl)prop-2-enamide (PubChem CID 71950270) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-cyano-N-(3-ethoxyphenyl)-3-(1H-indol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(3-ethoxyphenyl)-3-(1H-indol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71950270 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-cyano-N-(3-ethoxyphenyl)-3-(1H-indol-2-yl)prop-2-enamide |
| SMILES | CCOc1cccc(NC(=O)C(C#N)=Cc2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-25-18-8-5-7-16(12-18)23-20(24)15(13-21)11-17-10-14-6-3-4-9-19(14)22-17/h3-12,22H,2H2,1H3,(H,23,24) |
| InChIKey | YSIFIRFGHXGHFM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|