C22H20N6O5 — CID 71960653
3-(1,3-benzodioxol-5-yl)-N-[4-[4-[2-(cyclopropylamino)-2-oxoethyl]-5-oxotetrazol-1-yl]phenyl]prop-2-enamide (PubChem CID 71960653) has the molecular formula C22H20N6O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-[4-[2-(cyclopropylamino)-2-oxoethyl]-5-oxotetrazol-1-yl]phenyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-[4-[2-(cyclopropylamino)-2-oxoethyl]-5-oxotetrazol-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71960653 |
| Molecular Formula | C22H20N6O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-[4-[2-(cyclopropylamino)-2-oxoethyl]-5-oxotetrazol-1-yl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)Nc1ccc(-n2nnn(CC(=O)NC3CC3)c2=O)cc1 |
| InChI | InChI=1S/C22H20N6O5/c29-20(10-2-14-1-9-18-19(11-14)33-13-32-18)23-16-5-7-17(8-6-16)28-22(31)27(25-26-28)12-21(30)24-15-3-4-15/h1-2,5-11,15H,3-4,12-13H2,(H,23,29)(H,24,30) |
| InChIKey | JJRNCJYARPBYCY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|