C32H26N4O4S — CID 71966832
2-[[2-[5-oxo-1-phenyl-4-[(3-phenylmethoxyphenyl)methylidene]imidazol-2-yl]sulfanylacetyl]amino]benzamide (PubChem CID 71966832) has the molecular formula C32H26N4O4S and a molecular weight of 562.65 g/mol. Its IUPAC name is 2-[[2-[5-oxo-1-phenyl-4-[(3-phenylmethoxyphenyl)methylidene]imidazol-2-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[5-oxo-1-phenyl-4-[(3-phenylmethoxyphenyl)methylidene]imidazol-2-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 71966832 |
| Molecular Formula | C32H26N4O4S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 2-[[2-[5-oxo-1-phenyl-4-[(3-phenylmethoxyphenyl)methylidene]imidazol-2-yl]sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CSC1=NC(=Cc2cccc(OCc3ccccc3)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C32H26N4O4S/c33-30(38)26-16-7-8-17-27(26)34-29(37)21-41-32-35-28(31(39)36(32)24-13-5-2-6-14-24)19-23-12-9-15-25(18-23)40-20-22-10-3-1-4-11-22/h1-19H,20-21H2,(H2,33,38)(H,34,37) |
| InChIKey | XXMOSJBTIMAXHK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|