C9H11Cl2NO3S2 — CID 71971792
4-(2,5-dichlorothiophen-3-yl)-N-methylsulfonylbutanamide (PubChem CID 71971792) has the molecular formula C9H11Cl2NO3S2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophen-3-yl)-N-methylsulfonylbutanamide.
| Compound Name | 4-(2,5-dichlorothiophen-3-yl)-N-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 71971792 |
| Molecular Formula | C9H11Cl2NO3S2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 4-(2,5-dichlorothiophen-3-yl)-N-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)NC(=O)CCCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H11Cl2NO3S2/c1-17(14,15)12-8(13)4-2-3-6-5-7(10)16-9(6)11/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | KDECFSLKTOEKKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |