C17H21N5OS — CID 71977248
1-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]urea (PubChem CID 71977248) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]urea.
| Compound Name | 1-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]urea |
|---|---|
| PubChem CID | 71977248 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]urea |
| SMILES | Cc1ccc(CN(C)C(=O)NCCCc2nnc3ccccn23)s1 |
| InChI | InChI=1S/C17H21N5OS/c1-13-8-9-14(24-13)12-21(2)17(23)18-10-5-7-16-20-19-15-6-3-4-11-22(15)16/h3-4,6,8-9,11H,5,7,10,12H2,1-2H3,(H,18,23) |
| InChIKey | NRXNZUQATYMNPO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|