About methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate
methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate (PubChem CID 71995596) has the molecular formula C15H10F2N2O4
and a molecular weight of 320.25 g/mol. Its IUPAC name is methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate |
| PubChem CID | 71995596 |
| Molecular Formula | C15H10F2N2O4 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1Cn1c(=O)cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H10F2N2O4/c1-22-15(21)14-8(2-3-23-14)7-19-12-5-10(17)9(16)4-11(12)18-6-13(19)20/h2-6H,7H2,1H3 |
| InChIKey | PSAIAPBGMZMOBT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate?
The IUPAC name of methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate (CID 71995596) is methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate?
The canonical SMILES for methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate is COC(=O)c1occc1Cn1c(=O)cnc2cc(F)c(F)cc21.
What is the InChIKey of methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate?
The InChIKey is PSAIAPBGMZMOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N2O4/c1-22-15(21)14-8(2-3-23-14)7-19-12-5-10(17)9(16)4-11(12)18-6-13(19)20/h2-6H,7H2,1H3.
What are the key properties of methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate?
methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate has a molecular weight of 320.25 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(6,7-difluoro-2-oxoquinoxalin-1-yl)methyl]furan-2-carboxylate is sourced from PubChem (CID 71995596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).