C14H21N2O6+ — CID 7212522
[(2S)-2-hydroxy-3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)oxy]propyl]-propan-2-ylazanium (PubChem CID 7212522) has the molecular formula C14H21N2O6+ and a molecular weight of 313.33 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)oxy]propyl]-propan-2-ylazanium.
| Compound Name | [(2S)-2-hydroxy-3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)oxy]propyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 7212522 |
| Molecular Formula | C14H21N2O6+ |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [(2S)-2-hydroxy-3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)oxy]propyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]C[C@H](O)COc1cc([N+](=O)[O-])cc2c1OCCO2 |
| InChI | InChI=1S/C14H20N2O6/c1-9(2)15-7-11(17)8-22-13-6-10(16(18)19)5-12-14(13)21-4-3-20-12/h5-6,9,11,15,17H,3-4,7-8H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | LPKNBQXKQGCHTC-NSHDSACASA-O |
| XLogP | 0.08 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|