C24H32N6+2 — CID 7221369
1-benzhydryl-4-[(1-cyclopentyltetrazol-5-yl)methyl]piperazine-1,4-diium (PubChem CID 7221369) has the molecular formula C24H32N6+2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-benzhydryl-4-[(1-cyclopentyltetrazol-5-yl)methyl]piperazine-1,4-diium.
| Compound Name | 1-benzhydryl-4-[(1-cyclopentyltetrazol-5-yl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7221369 |
| Molecular Formula | C24H32N6+2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-benzhydryl-4-[(1-cyclopentyltetrazol-5-yl)methyl]piperazine-1,4-diium |
| SMILES | c1ccc(C(c2ccccc2)[NH+]2CC[NH+](Cc3nnnn3C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H30N6/c1-3-9-20(10-4-1)24(21-11-5-2-6-12-21)29-17-15-28(16-18-29)19-23-25-26-27-30(23)22-13-7-8-14-22/h1-6,9-12,22,24H,7-8,13-19H2/p+2 |
| InChIKey | DMRMUHYCIYWJAU-UHFFFAOYSA-P |
| XLogP | 0.86 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |