C15H13N3O5 — CID 7250575
(3-cyano-4-imino-2-oxopentyl) 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 7250575) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 7250575 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C15H13N3O5/c1-9(17)10(6-16)12(19)8-22-14(20)7-18-11-4-2-3-5-13(11)23-15(18)21/h2-5,10,17H,7-8H2,1H3/b17-9+ |
| InChIKey | ISFJAICTOWRBJX-RQZCQDPDSA-N |
| XLogP | 0.89 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|