C11H15N3O5 — CID 72527724
(2,5-dioxopyrrolidin-1-yl) N-(7-oxoazepan-4-yl)carbamate (PubChem CID 72527724) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-(7-oxoazepan-4-yl)carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-(7-oxoazepan-4-yl)carbamate |
|---|---|
| PubChem CID | 72527724 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-(7-oxoazepan-4-yl)carbamate |
| SMILES | O=C1CCC(NC(=O)ON2C(=O)CCC2=O)CCN1 |
| InChI | InChI=1S/C11H15N3O5/c15-8-2-1-7(5-6-12-8)13-11(18)19-14-9(16)3-4-10(14)17/h7H,1-6H2,(H,12,15)(H,13,18) |
| InChIKey | JBSKIFFBOAASTK-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|