C36H38N2O4 — CID 72528156
ethyl 2-[3-[3-[3,3-diphenylpropyl(3-pyridin-4-ylprop-2-enoyl)amino]propyl]phenoxy]acetate (PubChem CID 72528156) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is ethyl 2-[3-[3-[3,3-diphenylpropyl(3-pyridin-4-ylprop-2-enoyl)amino]propyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[3-[3,3-diphenylpropyl(3-pyridin-4-ylprop-2-enoyl)amino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 72528156 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | ethyl 2-[3-[3-[3,3-diphenylpropyl(3-pyridin-4-ylprop-2-enoyl)amino]propyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(CCCN(CCC(c2ccccc2)c2ccccc2)C(=O)C=Cc2ccncc2)c1 |
| InChI | InChI=1S/C36H38N2O4/c1-2-41-36(40)28-42-33-17-9-11-30(27-33)12-10-25-38(35(39)19-18-29-20-23-37-24-21-29)26-22-34(31-13-5-3-6-14-31)32-15-7-4-8-16-32/h3-9,11,13-21,23-24,27,34H,2,10,12,22,25-26,28H2,1H3 |
| InChIKey | JLUSZFAXNACNHE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|