About [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate
[3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate (PubChem CID 91384180) has the molecular formula C33H34N2O5S
and a molecular weight of 570.71 g/mol. Its IUPAC name is [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate.
Molecular Properties
| Compound Name | [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate |
| PubChem CID | 91384180 |
| Molecular Formula | C33H34N2O5S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(CCCN(CCC(c2ccccc2)c2ccccc2)C(=O)c2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C33H34N2O5S/c1-25(36)40-30-18-8-11-26(23-30)12-10-21-35(33(37)29-17-9-19-31(24-29)41(34,38)39)22-20-32(27-13-4-2-5-14-27)28-15-6-3-7-16-28/h2-9,11,13-19,23-24,32H,10,12,20-22H2,1H3,(H2,34,38,39) |
| InChIKey | LBSMMAZCZGNYRM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate?
The IUPAC name of [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate (CID 91384180) is [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate.
What is the SMILES notation for [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate?
The canonical SMILES for [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate is CC(=O)Oc1cccc(CCCN(CCC(c2ccccc2)c2ccccc2)C(=O)c2cccc(S(N)(=O)=O)c2)c1.
What is the InChIKey of [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate?
The InChIKey is LBSMMAZCZGNYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34N2O5S/c1-25(36)40-30-18-8-11-26(23-30)12-10-21-35(33(37)29-17-9-19-31(24-29)41(34,38)39)22-20-32(27-13-4-2-5-14-27)28-15-6-3-7-16-28/h2-9,11,13-19,23-24,32H,10,12,20-22H2,1H3,(H2,34,38,39).
What are the key properties of [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate?
[3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate has a molecular weight of 570.71 g/mol, XLogP of 5.56, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-[3,3-diphenylpropyl-(3-sulfamoylbenzoyl)amino]propyl]phenyl] acetate is sourced from PubChem (CID 91384180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).