C28H20ClNO5S — CID 72546225
[4-[(4-chlorophenyl)methylamino]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate (PubChem CID 72546225) has the molecular formula C28H20ClNO5S and a molecular weight of 517.99 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methylamino]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(4-chlorophenyl)methylamino]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 72546225 |
| Molecular Formula | C28H20ClNO5S |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | [4-[(4-chlorophenyl)methylamino]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(NCc3ccc(Cl)cc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H20ClNO5S/c1-17-6-12-20(13-7-17)36(33,34)35-24-15-14-23(30-16-18-8-10-19(29)11-9-18)25-26(24)28(32)22-5-3-2-4-21(22)27(25)31/h2-15,30H,16H2,1H3 |
| InChIKey | OXVYDTTZLHYWNT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|