C24H20N2O3 — CID 102057902
N-[4-(benzylamino)-9,10-dioxoanthracen-1-yl]-N-methylacetamide (PubChem CID 102057902) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[4-(benzylamino)-9,10-dioxoanthracen-1-yl]-N-methylacetamide.
| Compound Name | N-[4-(benzylamino)-9,10-dioxoanthracen-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 102057902 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[4-(benzylamino)-9,10-dioxoanthracen-1-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(NCc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H20N2O3/c1-15(27)26(2)20-13-12-19(25-14-16-8-4-3-5-9-16)21-22(20)24(29)18-11-7-6-10-17(18)23(21)28/h3-13,25H,14H2,1-2H3 |
| InChIKey | VOWZPBJKDYEUTB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|