C24H23N3O3 — CID 7694267
1-amino-4-(benzylamino)-2-[2-hydroxyethyl(methyl)amino]anthracene-9,10-dione (PubChem CID 7694267) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-amino-4-(benzylamino)-2-[2-hydroxyethyl(methyl)amino]anthracene-9,10-dione.
| Compound Name | 1-amino-4-(benzylamino)-2-[2-hydroxyethyl(methyl)amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 7694267 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-amino-4-(benzylamino)-2-[2-hydroxyethyl(methyl)amino]anthracene-9,10-dione |
| SMILES | CN(CCO)c1cc(NCc2ccccc2)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H23N3O3/c1-27(11-12-28)19-13-18(26-14-15-7-3-2-4-8-15)20-21(22(19)25)24(30)17-10-6-5-9-16(17)23(20)29/h2-10,13,26,28H,11-12,14,25H2,1H3 |
| InChIKey | CFLYUTNGFKDIIT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|