C21H15FN2O2S — CID 54379227
[1-amino-4-(benzylamino)-9,10-dioxoanthracen-2-yl] thiohypofluorite (PubChem CID 54379227) has the molecular formula C21H15FN2O2S and a molecular weight of 378.43 g/mol. Its IUPAC name is [1-amino-4-(benzylamino)-9,10-dioxoanthracen-2-yl] thiohypofluorite.
| Compound Name | [1-amino-4-(benzylamino)-9,10-dioxoanthracen-2-yl] thiohypofluorite |
|---|---|
| PubChem CID | 54379227 |
| Molecular Formula | C21H15FN2O2S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [1-amino-4-(benzylamino)-9,10-dioxoanthracen-2-yl] thiohypofluorite |
| SMILES | Nc1c(SF)cc(NCc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H15FN2O2S/c22-27-16-10-15(24-11-12-6-2-1-3-7-12)17-18(19(16)23)21(26)14-9-5-4-8-13(14)20(17)25/h1-10,24H,11,23H2 |
| InChIKey | UYTPXAVUEFUJIL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|