C13H11NO4 — CID 776376
N-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-N-methylacetamide (PubChem CID 776376) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is N-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-N-methylacetamide.
| Compound Name | N-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 776376 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)C1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C13H11NO4/c1-7(15)14(2)10-11(16)8-5-3-4-6-9(8)12(17)13(10)18/h3-6,16H,1-2H3 |
| InChIKey | NZHPDSSYLDTOHU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|