C34H47N3O7 — CID 72547356
tert-butyl N-[1-[2-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)-5-prop-2-enylanilino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 72547356) has the molecular formula C34H47N3O7 and a molecular weight of 609.76 g/mol. Its IUPAC name is tert-butyl N-[1-[2-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)-5-prop-2-enylanilino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)-5-prop-2-enylanilino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 72547356 |
| Molecular Formula | C34H47N3O7 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | tert-butyl N-[1-[2-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)-5-prop-2-enylanilino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | C=CCc1cc(NC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c(O)c(-c2ccc(O)c(CC=C)c2)c1 |
| InChI | InChI=1S/C34H47N3O7/c1-9-13-22-19-25(23-16-17-28(38)24(21-23)14-10-2)29(39)27(20-22)36-30(40)26(37-32(42)44-34(6,7)8)15-11-12-18-35-31(41)43-33(3,4)5/h9-10,16-17,19-21,26,38-39H,1-2,11-15,18H2,3-8H3,(H,35,41)(H,36,40)(H,37,42) |
| InChIKey | GQEGUVILNXIJPJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 146.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|