C36H41N3O7 — CID 11422238
tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)amino]hexan-2-yl]carbamate (PubChem CID 11422238) has the molecular formula C36H41N3O7 and a molecular weight of 627.74 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)amino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 11422238 |
| Molecular Formula | C36H41N3O7 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | tert-butyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxo-1-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)amino]hexan-2-yl]carbamate |
| SMILES | C=CCc1cc2c(cc1NC(=O)[C@H](CCCCNC(=O)OCC1c3ccccc3-c3ccccc31)NC(=O)OC(C)(C)C)OCO2 |
| InChI | InChI=1S/C36H41N3O7/c1-5-12-23-19-31-32(45-22-44-31)20-30(23)38-33(40)29(39-35(42)46-36(2,3)4)17-10-11-18-37-34(41)43-21-28-26-15-8-6-13-24(26)25-14-7-9-16-27(25)28/h5-9,13-16,19-20,28-29H,1,10-12,17-18,21-22H2,2-4H3,(H,37,41)(H,38,40)(H,39,42)/t29-/m0/s1 |
| InChIKey | NZAMCAODUZRDHN-LJAQVGFWSA-N |
| XLogP | 6.68 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|