C25H19F2N5O3S2 — CID 72550507
[(4aR)-1-(4-fluorophenyl)-6-[(5-fluoro-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 72550507) has the molecular formula C25H19F2N5O3S2 and a molecular weight of 539.59 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-[(5-fluoro-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-[(5-fluoro-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 72550507 |
| Molecular Formula | C25H19F2N5O3S2 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-[(5-fluoro-3-pyridinyl)sulfonyl]-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1cncc(F)c1)C2 |
| InChI | InChI=1S/C25H19F2N5O3S2/c26-18-1-3-20(4-2-18)32-22-9-17-5-7-31(37(34,35)21-10-19(27)13-28-14-21)15-25(17,11-16(22)12-30-32)23(33)24-29-6-8-36-24/h1-4,6,8-10,12-14H,5,7,11,15H2/t25-/m0/s1 |
| InChIKey | WDCWLRKRIZSIQM-VWLOTQADSA-N |
| XLogP | 3.91 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |