C27H29NO4S — CID 72557024
N-[3-[1-(3-butoxy-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]phenyl]methanesulfonamide (PubChem CID 72557024) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-[3-[1-(3-butoxy-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[1-(3-butoxy-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 72557024 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[3-[1-(3-butoxy-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]phenyl]methanesulfonamide |
| SMILES | CCCCOc1ccc2c(c1)OCc1ccccc1C2=C(C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C27H29NO4S/c1-4-5-15-31-23-13-14-25-26(17-23)32-18-21-9-6-7-12-24(21)27(25)19(2)20-10-8-11-22(16-20)28-33(3,29)30/h6-14,16-17,28H,4-5,15,18H2,1-3H3 |
| InChIKey | JQFJJLCPXZFSCJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|