C23H19ClFNO3S — CID 76837871
N-[3-[1-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]-5-fluorophenyl]methanesulfonamide (PubChem CID 76837871) has the molecular formula C23H19ClFNO3S and a molecular weight of 443.93 g/mol. Its IUPAC name is N-[3-[1-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]-5-fluorophenyl]methanesulfonamide.
| Compound Name | N-[3-[1-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]-5-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 76837871 |
| Molecular Formula | C23H19ClFNO3S |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-[3-[1-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)ethyl]-5-fluorophenyl]methanesulfonamide |
| SMILES | CC(=C1c2ccc(Cl)cc2COc2ccccc21)c1cc(F)cc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H19ClFNO3S/c1-14(15-10-18(25)12-19(11-15)26-30(2,27)28)23-20-8-7-17(24)9-16(20)13-29-22-6-4-3-5-21(22)23/h3-12,26H,13H2,1-2H3 |
| InChIKey | LECVAEZHIRFIIN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|