C14H17FN2O2 — CID 72565182
methyl 2-[(4-fluorophenyl)methylamino]-2-azabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 72565182) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)methylamino]-2-azabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl 2-[(4-fluorophenyl)methylamino]-2-azabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 72565182 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)methylamino]-2-azabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | COC(=O)C12CC1CCN2NCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O2/c1-19-13(18)14-8-11(14)6-7-17(14)16-9-10-2-4-12(15)5-3-10/h2-5,11,16H,6-9H2,1H3 |
| InChIKey | KUBHAMDGDKFRDL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |