About [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate
[1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate (PubChem CID 72565732) has the molecular formula C24H27NO5S
and a molecular weight of 441.55 g/mol. Its IUPAC name is [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate |
| PubChem CID | 72565732 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(C(C)=NOS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H27NO5S/c1-5-24(3,4)23(29-26)20-12-10-18(11-13-20)17(2)25-30-31(27,28)22-15-14-19-8-6-7-9-21(19)16-22/h6-16,23,26H,5H2,1-4H3 |
| InChIKey | AQWAUWKBEMXILZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate?
The IUPAC name of [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate (CID 72565732) is [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate.
What is the SMILES notation for [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate?
The canonical SMILES for [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate is CCC(C)(C)C(OO)c1ccc(C(C)=NOS(=O)(=O)c2ccc3ccccc3c2)cc1.
What is the InChIKey of [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate?
The InChIKey is AQWAUWKBEMXILZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO5S/c1-5-24(3,4)23(29-26)20-12-10-18(11-13-20)17(2)25-30-31(27,28)22-15-14-19-8-6-7-9-21(19)16-22/h6-16,23,26H,5H2,1-4H3.
What are the key properties of [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate?
[1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate has a molecular weight of 441.55 g/mol, XLogP of 5.94, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] naphthalene-2-sulfonate is sourced from PubChem (CID 72565732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).