C22H20F9NO5S — CID 59801370
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 59801370) has the molecular formula C22H20F9NO5S and a molecular weight of 581.45 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 59801370 |
| Molecular Formula | C22H20F9NO5S |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F9NO5S/c1-4-19(2,3)18(36-33)13-7-5-12(6-8-13)17(22(29,30)31)32-37-38(34,35)16-10-14(20(23,24)25)9-15(11-16)21(26,27)28/h5-11,18,33H,4H2,1-3H3/b32-17+ |
| InChIKey | LJSZUVQYJAUHNG-VTNSRFBWSA-N |
| XLogP | 7.36 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|