C21H18F9NO5S — CID 59801409
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 59801409) has the molecular formula C21H18F9NO5S and a molecular weight of 567.43 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 59801409 |
| Molecular Formula | C21H18F9NO5S |
| Molecular Weight | 567.43 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F9NO5S/c1-3-11(2)17(35-32)12-4-6-13(7-5-12)18(21(28,29)30)31-36-37(33,34)16-9-14(19(22,23)24)8-15(10-16)20(25,26)27/h4-11,17,32H,3H2,1-2H3/b31-18+ |
| InChIKey | UJEJQFMHPSVNPQ-FDAWAROLSA-N |
| XLogP | 6.97 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.43 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|