C24H24F6O7S — CID 88920688
1-O-ethyl 3-O-[1-(4-methylphenyl)ethyl] 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonyloxymethyl]-2-methylpropanedioate (PubChem CID 88920688) has the molecular formula C24H24F6O7S and a molecular weight of 570.50 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[1-(4-methylphenyl)ethyl] 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonyloxymethyl]-2-methylpropanedioate.
| Compound Name | 1-O-ethyl 3-O-[1-(4-methylphenyl)ethyl] 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonyloxymethyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 88920688 |
| Molecular Formula | C24H24F6O7S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 1-O-ethyl 3-O-[1-(4-methylphenyl)ethyl] 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonyloxymethyl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(COS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)OC(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H24F6O7S/c1-5-35-20(31)22(4,21(32)37-15(3)16-8-6-14(2)7-9-16)13-36-38(33,34)19-11-17(23(25,26)27)10-18(12-19)24(28,29)30/h6-12,15H,5,13H2,1-4H3 |
| InChIKey | ZCWKMUAXGWSBOV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|