C23H43NO2Si — CID 72594676
5-[tert-butyl(dimethyl)silyl]oxy-N,N-dicyclohexylpent-2-enamide (PubChem CID 72594676) has the molecular formula C23H43NO2Si and a molecular weight of 393.69 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-N,N-dicyclohexylpent-2-enamide.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-N,N-dicyclohexylpent-2-enamide |
|---|---|
| PubChem CID | 72594676 |
| Molecular Formula | C23H43NO2Si |
| Molecular Weight | 393.69 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-N,N-dicyclohexylpent-2-enamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC=CC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H43NO2Si/c1-23(2,3)27(4,5)26-19-13-12-18-22(25)24(20-14-8-6-9-15-20)21-16-10-7-11-17-21/h12,18,20-21H,6-11,13-17,19H2,1-5H3 |
| InChIKey | WWSYVNNWIVZHAO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|