C20H19N5O5S2 — CID 72596586
1-[5-[2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea (PubChem CID 72596586) has the molecular formula C20H19N5O5S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-[5-[2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea.
| Compound Name | 1-[5-[2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 72596586 |
| Molecular Formula | C20H19N5O5S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 1-[5-[2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea |
| SMILES | CC(C)(C)c1cnc(C=Cc2cnc(NC(=O)Nc3ccc4c(c3)S(=O)(=O)NC4=O)s2)o1 |
| InChI | InChI=1S/C20H19N5O5S2/c1-20(2,3)15-10-21-16(30-15)7-5-12-9-22-19(31-12)24-18(27)23-11-4-6-13-14(8-11)32(28,29)25-17(13)26/h4-10H,1-3H3,(H,25,26)(H2,22,23,24,27) |
| InChIKey | RSXRYPJPBJWCSG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |