C21H26N6O3SSi — CID 72967728
1-(6-morpholin-4-yl-3-pyridinyl)-3-[5-[2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]urea (PubChem CID 72967728) has the molecular formula C21H26N6O3SSi and a molecular weight of 470.63 g/mol. Its IUPAC name is 1-(6-morpholin-4-yl-3-pyridinyl)-3-[5-[2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(6-morpholin-4-yl-3-pyridinyl)-3-[5-[2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 72967728 |
| Molecular Formula | C21H26N6O3SSi |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 1-(6-morpholin-4-yl-3-pyridinyl)-3-[5-[2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]urea |
| SMILES | C[Si](C)(C)c1cnc(C=Cc2cnc(NC(=O)Nc3ccc(N4CCOCC4)nc3)s2)o1 |
| InChI | InChI=1S/C21H26N6O3SSi/c1-32(2,3)19-14-23-18(30-19)7-5-16-13-24-21(31-16)26-20(28)25-15-4-6-17(22-12-15)27-8-10-29-11-9-27/h4-7,12-14H,8-11H2,1-3H3,(H2,24,25,26,28) |
| InChIKey | CYYFKQPJDQCCPJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|